C18H22N3O6+ — CID 7120218
(2S)-3-acetyl-4-hydroxy-1-(2-morpholin-4-ium-4-ylethyl)-2-(4-nitrophenyl)-2H-pyrrol-5-one (PubChem CID 7120218) has the molecular formula C18H22N3O6+ and a molecular weight of 376.39 g/mol. Its IUPAC name is (2S)-3-acetyl-4-hydroxy-1-(2-morpholin-4-ium-4-ylethyl)-2-(4-nitrophenyl)-2H-pyrrol-5-one.
| Compound Name | (2S)-3-acetyl-4-hydroxy-1-(2-morpholin-4-ium-4-ylethyl)-2-(4-nitrophenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 7120218 |
| Molecular Formula | C18H22N3O6+ |
| Molecular Weight | 376.39 g/mol |
| Exact Mass | 376.15 |
| IUPAC Name | (2S)-3-acetyl-4-hydroxy-1-(2-morpholin-4-ium-4-ylethyl)-2-(4-nitrophenyl)-2H-pyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(=O)N(CC[NH+]2CCOCC2)[C@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C18H21N3O6/c1-12(22)15-16(13-2-4-14(5-3-13)21(25)26)20(18(24)17(15)23)7-6-19-8-10-27-11-9-19/h2-5,16,23H,6-11H2,1H3/p+1/t16-/m0/s1 |
| InChIKey | GSMLLFINWDTUJS-INIZCTEOSA-O |
| XLogP | -0.21 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.39 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|