C19H25N2O5+ — CID 3586144
3-acetyl-4-hydroxy-2-(2-methoxyphenyl)-1-(2-morpholin-4-ium-4-ylethyl)-2H-pyrrol-5-one (PubChem CID 3586144) has the molecular formula C19H25N2O5+ and a molecular weight of 361.42 g/mol. Its IUPAC name is 3-acetyl-4-hydroxy-2-(2-methoxyphenyl)-1-(2-morpholin-4-ium-4-ylethyl)-2H-pyrrol-5-one.
| Compound Name | 3-acetyl-4-hydroxy-2-(2-methoxyphenyl)-1-(2-morpholin-4-ium-4-ylethyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 3586144 |
| Molecular Formula | C19H25N2O5+ |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.18 |
| IUPAC Name | 3-acetyl-4-hydroxy-2-(2-methoxyphenyl)-1-(2-morpholin-4-ium-4-ylethyl)-2H-pyrrol-5-one |
| SMILES | COc1ccccc1C1C(C(C)=O)=C(O)C(=O)N1CC[NH+]1CCOCC1 |
| InChI | InChI=1S/C19H24N2O5/c1-13(22)16-17(14-5-3-4-6-15(14)25-2)21(19(24)18(16)23)8-7-20-9-11-26-12-10-20/h3-6,17,23H,7-12H2,1-2H3/p+1 |
| InChIKey | WYKKADQFYGUHSJ-UHFFFAOYSA-O |
| XLogP | -0.11 |
| TPSA | 80.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | -0.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |