C17H13N3O5 — CID 786176
(2R)-3-acetyl-4-hydroxy-2-(4-nitrophenyl)-1-pyridin-2-yl-2H-pyrrol-5-one (PubChem CID 786176) has the molecular formula C17H13N3O5 and a molecular weight of 339.31 g/mol. Its IUPAC name is (2R)-3-acetyl-4-hydroxy-2-(4-nitrophenyl)-1-pyridin-2-yl-2H-pyrrol-5-one.
| Compound Name | (2R)-3-acetyl-4-hydroxy-2-(4-nitrophenyl)-1-pyridin-2-yl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 786176 |
| Molecular Formula | C17H13N3O5 |
| Molecular Weight | 339.31 g/mol |
| Exact Mass | 339.09 |
| IUPAC Name | (2R)-3-acetyl-4-hydroxy-2-(4-nitrophenyl)-1-pyridin-2-yl-2H-pyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(=O)N(c2ccccn2)[C@@H]1c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C17H13N3O5/c1-10(21)14-15(11-5-7-12(8-6-11)20(24)25)19(17(23)16(14)22)13-4-2-3-9-18-13/h2-9,15,22H,1H3/t15-/m1/s1 |
| InChIKey | DYSKBOCYGXONHA-OAHLLOKOSA-N |
| XLogP | 2.48 |
| TPSA | 113.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.31 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|