C14H13BrFNO3 — CID 7306591
(2S)-3-acetyl-1-(2-bromoethyl)-2-(3-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one (PubChem CID 7306591) has the molecular formula C14H13BrFNO3 and a molecular weight of 342.16 g/mol. Its IUPAC name is (2S)-3-acetyl-1-(2-bromoethyl)-2-(3-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one.
| Compound Name | (2S)-3-acetyl-1-(2-bromoethyl)-2-(3-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 7306591 |
| Molecular Formula | C14H13BrFNO3 |
| Molecular Weight | 342.16 g/mol |
| Exact Mass | 341.01 |
| IUPAC Name | (2S)-3-acetyl-1-(2-bromoethyl)-2-(3-fluorophenyl)-4-hydroxy-2H-pyrrol-5-one |
| SMILES | CC(=O)C1=C(O)C(=O)N(CCBr)[C@H]1c1cccc(F)c1 |
| InChI | InChI=1S/C14H13BrFNO3/c1-8(18)11-12(9-3-2-4-10(16)7-9)17(6-5-15)14(20)13(11)19/h2-4,7,12,19H,5-6H2,1H3/t12-/m0/s1 |
| InChIKey | WTIHNLXXNITLCW-LBPRGKRZSA-N |
| XLogP | 2.51 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.16 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|