C21H29NO4 — CID 108613971
4-hydroxy-2-(3-methoxyphenyl)-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one (PubChem CID 108613971) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is 4-hydroxy-2-(3-methoxyphenyl)-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(3-methoxyphenyl)-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108613971 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | 4-hydroxy-2-(3-methoxyphenyl)-3-(3-methylbutanoyl)-1-pentyl-2H-pyrrol-5-one |
| SMILES | CCCCCN1C(=O)C(O)=C(C(=O)CC(C)C)C1c1cccc(OC)c1 |
| InChI | InChI=1S/C21H29NO4/c1-5-6-7-11-22-19(15-9-8-10-16(13-15)26-4)18(20(24)21(22)25)17(23)12-14(2)3/h8-10,13-14,19,24H,5-7,11-12H2,1-4H3 |
| InChIKey | PWOQCJUDAJBWSX-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|