C20H28N2O4 — CID 108578388
1-[2-(diethylamino)ethyl]-4-hydroxy-2-(3-methoxyphenyl)-3-propanoyl-2H-pyrrol-5-one (PubChem CID 108578388) has the molecular formula C20H28N2O4 and a molecular weight of 360.45 g/mol. Its IUPAC name is 1-[2-(diethylamino)ethyl]-4-hydroxy-2-(3-methoxyphenyl)-3-propanoyl-2H-pyrrol-5-one.
| Compound Name | 1-[2-(diethylamino)ethyl]-4-hydroxy-2-(3-methoxyphenyl)-3-propanoyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108578388 |
| Molecular Formula | C20H28N2O4 |
| Molecular Weight | 360.45 g/mol |
| Exact Mass | 360.20 |
| IUPAC Name | 1-[2-(diethylamino)ethyl]-4-hydroxy-2-(3-methoxyphenyl)-3-propanoyl-2H-pyrrol-5-one |
| SMILES | CCC(=O)C1=C(O)C(=O)N(CCN(CC)CC)C1c1cccc(OC)c1 |
| InChI | InChI=1S/C20H28N2O4/c1-5-16(23)17-18(14-9-8-10-15(13-14)26-4)22(20(25)19(17)24)12-11-21(6-2)7-3/h8-10,13,18,24H,5-7,11-12H2,1-4H3 |
| InChIKey | ZYPRWTHTEBUSJQ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.45 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |