C21H21NO4 — CID 108647473
4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-1-phenyl-2H-pyrrol-5-one (PubChem CID 108647473) has the molecular formula C21H21NO4 and a molecular weight of 351.40 g/mol. Its IUPAC name is 4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-1-phenyl-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-1-phenyl-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108647473 |
| Molecular Formula | C21H21NO4 |
| Molecular Weight | 351.40 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | 4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-1-phenyl-2H-pyrrol-5-one |
| SMILES | CC(C)CC(=O)C1=C(O)C(=O)N(c2ccccc2)C1c1cccc(O)c1 |
| InChI | InChI=1S/C21H21NO4/c1-13(2)11-17(24)18-19(14-7-6-10-16(23)12-14)22(21(26)20(18)25)15-8-4-3-5-9-15/h3-10,12-13,19,23,25H,11H2,1-2H3 |
| InChIKey | MGBBBXBXWKEMRB-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |