C25H21NO4 — CID 108647487
4-hydroxy-2-(3-hydroxyphenyl)-1-phenyl-3-(3-phenylpropanoyl)-2H-pyrrol-5-one (PubChem CID 108647487) has the molecular formula C25H21NO4 and a molecular weight of 399.45 g/mol. Its IUPAC name is 4-hydroxy-2-(3-hydroxyphenyl)-1-phenyl-3-(3-phenylpropanoyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(3-hydroxyphenyl)-1-phenyl-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108647487 |
| Molecular Formula | C25H21NO4 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-hydroxy-2-(3-hydroxyphenyl)-1-phenyl-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
| SMILES | O=C(CCc1ccccc1)C1=C(O)C(=O)N(c2ccccc2)C1c1cccc(O)c1 |
| InChI | InChI=1S/C25H21NO4/c27-20-13-7-10-18(16-20)23-22(21(28)15-14-17-8-3-1-4-9-17)24(29)25(30)26(23)19-11-5-2-6-12-19/h1-13,16,23,27,29H,14-15H2 |
| InChIKey | CBCTYKLYPOGNPC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |