C28H22N2O5 — CID 108688449
[3-[1-(4-cyanophenyl)-4-hydroxy-5-oxo-3-(3-phenylpropanoyl)-2H-pyrrol-2-yl]phenyl] acetate (PubChem CID 108688449) has the molecular formula C28H22N2O5 and a molecular weight of 466.49 g/mol. Its IUPAC name is [3-[1-(4-cyanophenyl)-4-hydroxy-5-oxo-3-(3-phenylpropanoyl)-2H-pyrrol-2-yl]phenyl] acetate.
| Compound Name | [3-[1-(4-cyanophenyl)-4-hydroxy-5-oxo-3-(3-phenylpropanoyl)-2H-pyrrol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108688449 |
| Molecular Formula | C28H22N2O5 |
| Molecular Weight | 466.49 g/mol |
| Exact Mass | 466.15 |
| IUPAC Name | [3-[1-(4-cyanophenyl)-4-hydroxy-5-oxo-3-(3-phenylpropanoyl)-2H-pyrrol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C2C(C(=O)CCc3ccccc3)=C(O)C(=O)N2c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C28H22N2O5/c1-18(31)35-23-9-5-8-21(16-23)26-25(24(32)15-12-19-6-3-2-4-7-19)27(33)28(34)30(26)22-13-10-20(17-29)11-14-22/h2-11,13-14,16,26,33H,12,15H2,1H3 |
| InChIKey | QXFCGOSAAFUXJF-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 107.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.49 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|