C24H16N2O6 — CID 108688436
[3-[1-(4-cyanophenyl)-3-(furan-2-carbonyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate (PubChem CID 108688436) has the molecular formula C24H16N2O6 and a molecular weight of 428.40 g/mol. Its IUPAC name is [3-[1-(4-cyanophenyl)-3-(furan-2-carbonyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate.
| Compound Name | [3-[1-(4-cyanophenyl)-3-(furan-2-carbonyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108688436 |
| Molecular Formula | C24H16N2O6 |
| Molecular Weight | 428.40 g/mol |
| Exact Mass | 428.10 |
| IUPAC Name | [3-[1-(4-cyanophenyl)-3-(furan-2-carbonyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
| SMILES | CC(=O)Oc1cccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2c2ccc(C#N)cc2)c1 |
| InChI | InChI=1S/C24H16N2O6/c1-14(27)32-18-5-2-4-16(12-18)21-20(22(28)19-6-3-11-31-19)23(29)24(30)26(21)17-9-7-15(13-25)8-10-17/h2-12,21,29H,1H3 |
| InChIKey | RPVYCNIWDBUPSU-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 120.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|