C25H21NO6 — CID 108687653
[4-[1-(4-ethylphenyl)-3-(furan-2-carbonyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate (PubChem CID 108687653) has the molecular formula C25H21NO6 and a molecular weight of 431.44 g/mol. Its IUPAC name is [4-[1-(4-ethylphenyl)-3-(furan-2-carbonyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate.
| Compound Name | [4-[1-(4-ethylphenyl)-3-(furan-2-carbonyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108687653 |
| Molecular Formula | C25H21NO6 |
| Molecular Weight | 431.44 g/mol |
| Exact Mass | 431.14 |
| IUPAC Name | [4-[1-(4-ethylphenyl)-3-(furan-2-carbonyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
| SMILES | CCc1ccc(N2C(=O)C(O)=C(C(=O)c3ccco3)C2c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C25H21NO6/c1-3-16-6-10-18(11-7-16)26-22(17-8-12-19(13-9-17)32-15(2)27)21(24(29)25(26)30)23(28)20-5-4-14-31-20/h4-14,22,29H,3H2,1-2H3 |
| InChIKey | WFYGRDYATPHJLG-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.44 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|