C29H22BrNO6 — CID 108687670
[4-[3-(5-bromo-1-benzofuran-2-carbonyl)-1-(4-ethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate (PubChem CID 108687670) has the molecular formula C29H22BrNO6 and a molecular weight of 560.40 g/mol. Its IUPAC name is [4-[3-(5-bromo-1-benzofuran-2-carbonyl)-1-(4-ethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate.
| Compound Name | [4-[3-(5-bromo-1-benzofuran-2-carbonyl)-1-(4-ethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108687670 |
| Molecular Formula | C29H22BrNO6 |
| Molecular Weight | 560.40 g/mol |
| Exact Mass | 559.06 |
| IUPAC Name | [4-[3-(5-bromo-1-benzofuran-2-carbonyl)-1-(4-ethylphenyl)-4-hydroxy-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
| SMILES | CCc1ccc(N2C(=O)C(O)=C(C(=O)c3cc4cc(Br)ccc4o3)C2c2ccc(OC(C)=O)cc2)cc1 |
| InChI | InChI=1S/C29H22BrNO6/c1-3-17-4-9-21(10-5-17)31-26(18-6-11-22(12-7-18)36-16(2)32)25(28(34)29(31)35)27(33)24-15-19-14-20(30)8-13-23(19)37-24/h4-15,26,34H,3H2,1-2H3 |
| InChIKey | XMQWNQGDQUKUHZ-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.40 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|