C23H23NO6 — CID 108688257
[3-[4-hydroxy-1-(4-methoxyphenyl)-3-(2-methylpropanoyl)-5-oxo-2H-pyrrol-2-yl]phenyl] acetate (PubChem CID 108688257) has the molecular formula C23H23NO6 and a molecular weight of 409.44 g/mol. Its IUPAC name is [3-[4-hydroxy-1-(4-methoxyphenyl)-3-(2-methylpropanoyl)-5-oxo-2H-pyrrol-2-yl]phenyl] acetate.
| Compound Name | [3-[4-hydroxy-1-(4-methoxyphenyl)-3-(2-methylpropanoyl)-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
|---|---|
| PubChem CID | 108688257 |
| Molecular Formula | C23H23NO6 |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | [3-[4-hydroxy-1-(4-methoxyphenyl)-3-(2-methylpropanoyl)-5-oxo-2H-pyrrol-2-yl]phenyl] acetate |
| SMILES | COc1ccc(N2C(=O)C(O)=C(C(=O)C(C)C)C2c2cccc(OC(C)=O)c2)cc1 |
| InChI | InChI=1S/C23H23NO6/c1-13(2)21(26)19-20(15-6-5-7-18(12-15)30-14(3)25)24(23(28)22(19)27)16-8-10-17(29-4)11-9-16/h5-13,20,27H,1-4H3 |
| InChIKey | VOKPPHFJNDMIPE-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|