C25H20FNO4 — CID 108616407
1-(3-fluorophenyl)-4-hydroxy-2-(4-hydroxyphenyl)-3-(3-phenylpropanoyl)-2H-pyrrol-5-one (PubChem CID 108616407) has the molecular formula C25H20FNO4 and a molecular weight of 417.44 g/mol. Its IUPAC name is 1-(3-fluorophenyl)-4-hydroxy-2-(4-hydroxyphenyl)-3-(3-phenylpropanoyl)-2H-pyrrol-5-one.
| Compound Name | 1-(3-fluorophenyl)-4-hydroxy-2-(4-hydroxyphenyl)-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108616407 |
| Molecular Formula | C25H20FNO4 |
| Molecular Weight | 417.44 g/mol |
| Exact Mass | 417.14 |
| IUPAC Name | 1-(3-fluorophenyl)-4-hydroxy-2-(4-hydroxyphenyl)-3-(3-phenylpropanoyl)-2H-pyrrol-5-one |
| SMILES | O=C(CCc1ccccc1)C1=C(O)C(=O)N(c2cccc(F)c2)C1c1ccc(O)cc1 |
| InChI | InChI=1S/C25H20FNO4/c26-18-7-4-8-19(15-18)27-23(17-10-12-20(28)13-11-17)22(24(30)25(27)31)21(29)14-9-16-5-2-1-3-6-16/h1-8,10-13,15,23,28,30H,9,14H2 |
| InChIKey | JYQRCLTUCUWWRU-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 77.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.44 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |