C29H27NO5 — CID 108683503
methyl 3-[2-(4-ethylphenyl)-4-hydroxy-5-oxo-3-(3-phenylpropanoyl)-2H-pyrrol-1-yl]benzoate (PubChem CID 108683503) has the molecular formula C29H27NO5 and a molecular weight of 469.54 g/mol. Its IUPAC name is methyl 3-[2-(4-ethylphenyl)-4-hydroxy-5-oxo-3-(3-phenylpropanoyl)-2H-pyrrol-1-yl]benzoate.
| Compound Name | methyl 3-[2-(4-ethylphenyl)-4-hydroxy-5-oxo-3-(3-phenylpropanoyl)-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 108683503 |
| Molecular Formula | C29H27NO5 |
| Molecular Weight | 469.54 g/mol |
| Exact Mass | 469.19 |
| IUPAC Name | methyl 3-[2-(4-ethylphenyl)-4-hydroxy-5-oxo-3-(3-phenylpropanoyl)-2H-pyrrol-1-yl]benzoate |
| SMILES | CCc1ccc(C2C(C(=O)CCc3ccccc3)=C(O)C(=O)N2c2cccc(C(=O)OC)c2)cc1 |
| InChI | InChI=1S/C29H27NO5/c1-3-19-12-15-21(16-13-19)26-25(24(31)17-14-20-8-5-4-6-9-20)27(32)28(33)30(26)23-11-7-10-22(18-23)29(34)35-2/h4-13,15-16,18,26,32H,3,14,17H2,1-2H3 |
| InChIKey | HRPSHBLTCUMTRM-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.54 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |