C24H25NO6 — CID 108682011
ethyl 4-[4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-5-oxo-2H-pyrrol-1-yl]benzoate (PubChem CID 108682011) has the molecular formula C24H25NO6 and a molecular weight of 423.47 g/mol. Its IUPAC name is ethyl 4-[4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-5-oxo-2H-pyrrol-1-yl]benzoate.
| Compound Name | ethyl 4-[4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-5-oxo-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 108682011 |
| Molecular Formula | C24H25NO6 |
| Molecular Weight | 423.47 g/mol |
| Exact Mass | 423.17 |
| IUPAC Name | ethyl 4-[4-hydroxy-2-(3-hydroxyphenyl)-3-(3-methylbutanoyl)-5-oxo-2H-pyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(N2C(=O)C(O)=C(C(=O)CC(C)C)C2c2cccc(O)c2)cc1 |
| InChI | InChI=1S/C24H25NO6/c1-4-31-24(30)15-8-10-17(11-9-15)25-21(16-6-5-7-18(26)13-16)20(22(28)23(25)29)19(27)12-14(2)3/h5-11,13-14,21,26,28H,4,12H2,1-3H3 |
| InChIKey | UOGCXJIJBJGRIM-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 104.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.47 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |