C25H27NO6 — CID 108699357
ethyl 3-[4-hydroxy-2-(3-methoxyphenyl)-3-(3-methylbutanoyl)-5-oxo-2H-pyrrol-1-yl]benzoate (PubChem CID 108699357) has the molecular formula C25H27NO6 and a molecular weight of 437.49 g/mol. Its IUPAC name is ethyl 3-[4-hydroxy-2-(3-methoxyphenyl)-3-(3-methylbutanoyl)-5-oxo-2H-pyrrol-1-yl]benzoate.
| Compound Name | ethyl 3-[4-hydroxy-2-(3-methoxyphenyl)-3-(3-methylbutanoyl)-5-oxo-2H-pyrrol-1-yl]benzoate |
|---|---|
| PubChem CID | 108699357 |
| Molecular Formula | C25H27NO6 |
| Molecular Weight | 437.49 g/mol |
| Exact Mass | 437.18 |
| IUPAC Name | ethyl 3-[4-hydroxy-2-(3-methoxyphenyl)-3-(3-methylbutanoyl)-5-oxo-2H-pyrrol-1-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(N2C(=O)C(O)=C(C(=O)CC(C)C)C2c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C25H27NO6/c1-5-32-25(30)17-9-6-10-18(13-17)26-22(16-8-7-11-19(14-16)31-4)21(23(28)24(26)29)20(27)12-15(2)3/h6-11,13-15,22,28H,5,12H2,1-4H3 |
| InChIKey | XDIKOKXWZKUOSB-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.49 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |