C25H27NO5 — CID 108694483
ethyl 4-[[4-hydroxy-3-(3-methylbutanoyl)-5-oxo-2-phenyl-2H-pyrrol-1-yl]methyl]benzoate (PubChem CID 108694483) has the molecular formula C25H27NO5 and a molecular weight of 421.49 g/mol. Its IUPAC name is ethyl 4-[[4-hydroxy-3-(3-methylbutanoyl)-5-oxo-2-phenyl-2H-pyrrol-1-yl]methyl]benzoate.
| Compound Name | ethyl 4-[[4-hydroxy-3-(3-methylbutanoyl)-5-oxo-2-phenyl-2H-pyrrol-1-yl]methyl]benzoate |
|---|---|
| PubChem CID | 108694483 |
| Molecular Formula | C25H27NO5 |
| Molecular Weight | 421.49 g/mol |
| Exact Mass | 421.19 |
| IUPAC Name | ethyl 4-[[4-hydroxy-3-(3-methylbutanoyl)-5-oxo-2-phenyl-2H-pyrrol-1-yl]methyl]benzoate |
| SMILES | CCOC(=O)c1ccc(CN2C(=O)C(O)=C(C(=O)CC(C)C)C2c2ccccc2)cc1 |
| InChI | InChI=1S/C25H27NO5/c1-4-31-25(30)19-12-10-17(11-13-19)15-26-22(18-8-6-5-7-9-18)21(23(28)24(26)29)20(27)14-16(2)3/h5-13,16,22,28H,4,14-15H2,1-3H3 |
| InChIKey | JKHCQJAFCQRKNN-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 83.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.49 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |