C35H31NO5 — CID 4697610
4-hydroxy-2-(3-methoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one (PubChem CID 4697610) has the molecular formula C35H31NO5 and a molecular weight of 545.64 g/mol. Its IUPAC name is 4-hydroxy-2-(3-methoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one.
| Compound Name | 4-hydroxy-2-(3-methoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 4697610 |
| Molecular Formula | C35H31NO5 |
| Molecular Weight | 545.64 g/mol |
| Exact Mass | 545.22 |
| IUPAC Name | 4-hydroxy-2-(3-methoxy-4-phenylmethoxyphenyl)-1-(2-phenylethyl)-3-(3-phenylprop-2-enoyl)-2H-pyrrol-5-one |
| SMILES | COc1cc(C2C(C(=O)C=Cc3ccccc3)=C(O)C(=O)N2CCc2ccccc2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H31NO5/c1-40-31-23-28(18-20-30(31)41-24-27-15-9-4-10-16-27)33-32(29(37)19-17-25-11-5-2-6-12-25)34(38)35(39)36(33)22-21-26-13-7-3-8-14-26/h2-20,23,33,38H,21-22,24H2,1H3 |
| InChIKey | KBMODXDWBDPLEK-UHFFFAOYSA-N |
| XLogP | 6.49 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.64 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|