C27H25NO3 — CID 124775903
(3aR,4R,7R,7aR)-2-(4-methoxyphenyl)-4,7-diphenyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione (PubChem CID 124775903) has the molecular formula C27H25NO3 and a molecular weight of 411.50 g/mol. Its IUPAC name is (3aR,4R,7R,7aR)-2-(4-methoxyphenyl)-4,7-diphenyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione.
| Compound Name | (3aR,4R,7R,7aR)-2-(4-methoxyphenyl)-4,7-diphenyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
|---|---|
| PubChem CID | 124775903 |
| Molecular Formula | C27H25NO3 |
| Molecular Weight | 411.50 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | (3aR,4R,7R,7aR)-2-(4-methoxyphenyl)-4,7-diphenyl-3a,4,5,6,7,7a-hexahydroisoindole-1,3-dione |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@H](C2=O)[C@H](c2ccccc2)CC[C@H]3c2ccccc2)cc1 |
| InChI | InChI=1S/C27H25NO3/c1-31-21-14-12-20(13-15-21)28-26(29)24-22(18-8-4-2-5-9-18)16-17-23(25(24)27(28)30)19-10-6-3-7-11-19/h2-15,22-25H,16-17H2,1H3/t22-,23-,24+,25+/m0/s1 |
| InChIKey | QLBWEDTZLSUCNV-CXSMSNRLSA-N |
| XLogP | 5.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.50 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|