C36H30N4O6 — CID 5234641
7,14-bis(4-methoxyphenyl)-4,11-diphenyl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 5234641) has the molecular formula C36H30N4O6 and a molecular weight of 614.66 g/mol. Its IUPAC name is 7,14-bis(4-methoxyphenyl)-4,11-diphenyl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | 7,14-bis(4-methoxyphenyl)-4,11-diphenyl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 5234641 |
| Molecular Formula | C36H30N4O6 |
| Molecular Weight | 614.66 g/mol |
| Exact Mass | 614.22 |
| IUPAC Name | 7,14-bis(4-methoxyphenyl)-4,11-diphenyl-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | COc1ccc(C2C3C(=O)N(c4ccccc4)C(=O)C3N3C(c4ccc(OC)cc4)C4C(=O)N(c5ccccc5)C(=O)C4N23)cc1 |
| InChI | InChI=1S/C36H30N4O6/c1-45-25-17-13-21(14-18-25)29-27-31(35(43)37(33(27)41)23-9-5-3-6-10-23)40-30(22-15-19-26(46-2)20-16-22)28-32(39(29)40)36(44)38(34(28)42)24-11-7-4-8-12-24/h3-20,27-32H,1-2H3 |
| InChIKey | XJTLODMSIWKUTL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.66 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|