C38H34N4O8 — CID 3897677
7,14-bis(2-methoxyphenyl)-4,11-bis(4-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 3897677) has the molecular formula C38H34N4O8 and a molecular weight of 674.71 g/mol. Its IUPAC name is 7,14-bis(2-methoxyphenyl)-4,11-bis(4-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | 7,14-bis(2-methoxyphenyl)-4,11-bis(4-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 3897677 |
| Molecular Formula | C38H34N4O8 |
| Molecular Weight | 674.71 g/mol |
| Exact Mass | 674.24 |
| IUPAC Name | 7,14-bis(2-methoxyphenyl)-4,11-bis(4-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | COc1ccc(N2C(=O)C3C(C2=O)N2C(c4ccccc4OC)C4C(=O)N(c5ccc(OC)cc5)C(=O)C4N2C3c2ccccc2OC)cc1 |
| InChI | InChI=1S/C38H34N4O8/c1-47-23-17-13-21(14-18-23)39-35(43)29-31(25-9-5-7-11-27(25)49-3)42-34-30(36(44)40(38(34)46)22-15-19-24(48-2)20-16-22)32(41(42)33(29)37(39)45)26-10-6-8-12-28(26)50-4/h5-20,29-34H,1-4H3 |
| InChIKey | BJLDGKVAMNXJPH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 118.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 50 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.71 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|