C48H36Cl2N4O6 — CID 2829237
4,11-bis[4-(4-chlorophenyl)phenyl]-7,14-bis(2-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone (PubChem CID 2829237) has the molecular formula C48H36Cl2N4O6 and a molecular weight of 835.74 g/mol. Its IUPAC name is 4,11-bis[4-(4-chlorophenyl)phenyl]-7,14-bis(2-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone.
| Compound Name | 4,11-bis[4-(4-chlorophenyl)phenyl]-7,14-bis(2-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
|---|---|
| PubChem CID | 2829237 |
| Molecular Formula | C48H36Cl2N4O6 |
| Molecular Weight | 835.74 g/mol |
| Exact Mass | 834.20 |
| IUPAC Name | 4,11-bis[4-(4-chlorophenyl)phenyl]-7,14-bis(2-methoxyphenyl)-1,4,8,11-tetrazatetracyclo[6.6.0.02,6.09,13]tetradecane-3,5,10,12-tetrone |
| SMILES | COc1ccccc1C1C2C(=O)N(c3ccc(-c4ccc(Cl)cc4)cc3)C(=O)C2N2C(c3ccccc3OC)C3C(=O)N(c4ccc(-c5ccc(Cl)cc5)cc4)C(=O)C3N12 |
| InChI | InChI=1S/C48H36Cl2N4O6/c1-59-37-9-5-3-7-35(37)41-39-43(47(57)51(45(39)55)33-23-15-29(16-24-33)27-11-19-31(49)20-12-27)54-42(36-8-4-6-10-38(36)60-2)40-44(53(41)54)48(58)52(46(40)56)34-25-17-30(18-26-34)28-13-21-32(50)22-14-28/h3-26,39-44H,1-2H3 |
| InChIKey | UISLFVROVIUOBC-UHFFFAOYSA-N |
| XLogP | 8.79 |
| TPSA | 99.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 835.74 |
| LogP ≤ 5 | 8.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|