C21H17NO4 — CID 98244848
(1S,8S,9S,13R)-11-(4-methoxyphenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione (PubChem CID 98244848) has the molecular formula C21H17NO4 and a molecular weight of 347.37 g/mol. Its IUPAC name is (1S,8S,9S,13R)-11-(4-methoxyphenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione.
| Compound Name | (1S,8S,9S,13R)-11-(4-methoxyphenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
|---|---|
| PubChem CID | 98244848 |
| Molecular Formula | C21H17NO4 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | (1S,8S,9S,13R)-11-(4-methoxyphenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
| SMILES | COc1ccc(N2C(=O)[C@@H]3[C@H](C2=O)[C@@H]2C(=O)C[C@@H]3c3ccccc32)cc1 |
| InChI | InChI=1S/C21H17NO4/c1-26-12-8-6-11(7-9-12)22-20(24)18-15-10-16(23)17(19(18)21(22)25)14-5-3-2-4-13(14)15/h2-9,15,17-19H,10H2,1H3/t15-,17+,18+,19-/m1/s1 |
| InChIKey | DODZACSBQUZIMD-XGXHKWSGSA-N |
| XLogP | 2.65 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|