C26H21NO3 — CID 71675518
17-(4-methoxyphenyl)-4-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione (PubChem CID 71675518) has the molecular formula C26H21NO3 and a molecular weight of 395.46 g/mol. Its IUPAC name is 17-(4-methoxyphenyl)-4-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione.
| Compound Name | 17-(4-methoxyphenyl)-4-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 71675518 |
| Molecular Formula | C26H21NO3 |
| Molecular Weight | 395.46 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | 17-(4-methoxyphenyl)-4-methyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione |
| SMILES | COc1ccc(N2C(=O)C3C4c5ccccc5C(c5cc(C)ccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C26H21NO3/c1-14-7-12-19-20(13-14)22-18-6-4-3-5-17(18)21(19)23-24(22)26(29)27(25(23)28)15-8-10-16(30-2)11-9-15/h3-13,21-24H,1-2H3 |
| InChIKey | ICWYKGGNTZQUAE-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.46 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|