C33H35NO3 — CID 98169691
(1R,8S,15S,19S)-4,11-ditert-butyl-17-(4-methoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione (PubChem CID 98169691) has the molecular formula C33H35NO3 and a molecular weight of 493.65 g/mol. Its IUPAC name is (1R,8S,15S,19S)-4,11-ditert-butyl-17-(4-methoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione.
| Compound Name | (1R,8S,15S,19S)-4,11-ditert-butyl-17-(4-methoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
|---|---|
| PubChem CID | 98169691 |
| Molecular Formula | C33H35NO3 |
| Molecular Weight | 493.65 g/mol |
| Exact Mass | 493.26 |
| IUPAC Name | (1R,8S,15S,19S)-4,11-ditert-butyl-17-(4-methoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
| SMILES | COc1ccc(N2C(=O)[C@H]3[C@@H]4c5ccc(C(C)(C)C)cc5[C@H](c5ccc(C(C)(C)C)cc54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C33H35NO3/c1-32(2,3)18-8-14-22-24(16-18)26-23-15-9-19(33(4,5)6)17-25(23)27(22)29-28(26)30(35)34(31(29)36)20-10-12-21(37-7)13-11-20/h8-17,26-29H,1-7H3/t26-,27+,28-,29-/m0/s1 |
| InChIKey | BQXXFDYUKWXKBC-CRNKYVSFSA-N |
| XLogP | 6.69 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.65 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|