C38H36BrNO3 — CID 94864455
(1R,8R,15R,19R)-17-[4-(4-bromophenoxy)phenyl]-4,11-ditert-butyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione (PubChem CID 94864455) has the molecular formula C38H36BrNO3 and a molecular weight of 634.61 g/mol. Its IUPAC name is (1R,8R,15R,19R)-17-[4-(4-bromophenoxy)phenyl]-4,11-ditert-butyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione.
| Compound Name | (1R,8R,15R,19R)-17-[4-(4-bromophenoxy)phenyl]-4,11-ditert-butyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
|---|---|
| PubChem CID | 94864455 |
| Molecular Formula | C38H36BrNO3 |
| Molecular Weight | 634.61 g/mol |
| Exact Mass | 633.19 |
| IUPAC Name | (1R,8R,15R,19R)-17-[4-(4-bromophenoxy)phenyl]-4,11-ditert-butyl-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
| SMILES | CC(C)(C)c1ccc2c(c1)[C@H]1c3ccc(C(C)(C)C)cc3[C@@H]2[C@H]2C(=O)N(c3ccc(Oc4ccc(Br)cc4)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C38H36BrNO3/c1-37(2,3)21-7-17-27-29(19-21)31-28-18-8-22(38(4,5)6)20-30(28)32(27)34-33(31)35(41)40(36(34)42)24-11-15-26(16-12-24)43-25-13-9-23(39)10-14-25/h7-20,31-34H,1-6H3/t31-,32-,33-,34-/m1/s1 |
| InChIKey | DMJUFGURQRTSRO-YFRBGRBWSA-N |
| XLogP | 9.23 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.61 |
| LogP ≤ 5 | 9.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|