C37H43NO3 — CID 98169535
(1S,8R,15R,19S)-4,11-ditert-butyl-17-(4-pentoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione (PubChem CID 98169535) has the molecular formula C37H43NO3 and a molecular weight of 549.76 g/mol. Its IUPAC name is (1S,8R,15R,19S)-4,11-ditert-butyl-17-(4-pentoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione.
| Compound Name | (1S,8R,15R,19S)-4,11-ditert-butyl-17-(4-pentoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
|---|---|
| PubChem CID | 98169535 |
| Molecular Formula | C37H43NO3 |
| Molecular Weight | 549.76 g/mol |
| Exact Mass | 549.32 |
| IUPAC Name | (1S,8R,15R,19S)-4,11-ditert-butyl-17-(4-pentoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9(14),10,12-hexaene-16,18-dione |
| SMILES | CCCCCOc1ccc(N2C(=O)[C@@H]3[C@@H]4c5cc(C(C)(C)C)ccc5[C@H](c5cc(C(C)(C)C)ccc54)[C@@H]3C2=O)cc1 |
| InChI | InChI=1S/C37H43NO3/c1-8-9-10-19-41-25-15-13-24(14-16-25)38-34(39)32-30-27-18-12-23(37(5,6)7)21-29(27)31(33(32)35(38)40)26-17-11-22(20-28(26)30)36(2,3)4/h11-18,20-21,30-33H,8-10,19H2,1-7H3/t30-,31+,32+,33- |
| InChIKey | WFSIPXKAGXIRMM-NJRHJFJMSA-N |
| XLogP | 8.25 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.76 |
| LogP ≤ 5 | 8.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|