C31H31NO3 — CID 163168117
(1R,8R,15R,19R)-4-tert-butyl-17-(2-propoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione (PubChem CID 163168117) has the molecular formula C31H31NO3 and a molecular weight of 465.59 g/mol. Its IUPAC name is (1R,8R,15R,19R)-4-tert-butyl-17-(2-propoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione.
| Compound Name | (1R,8R,15R,19R)-4-tert-butyl-17-(2-propoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 163168117 |
| Molecular Formula | C31H31NO3 |
| Molecular Weight | 465.59 g/mol |
| Exact Mass | 465.23 |
| IUPAC Name | (1R,8R,15R,19R)-4-tert-butyl-17-(2-propoxyphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2(7),3,5,9,11,13-hexaene-16,18-dione |
| SMILES | CCCOc1ccccc1N1C(=O)[C@@H]2[C@@H]3c4ccccc4[C@H](c4cc(C(C)(C)C)ccc43)[C@H]2C1=O |
| InChI | InChI=1S/C31H31NO3/c1-5-16-35-24-13-9-8-12-23(24)32-29(33)27-25-19-10-6-7-11-20(19)26(28(27)30(32)34)22-17-18(31(2,3)4)14-15-21(22)25/h6-15,17,25-28H,5,16H2,1-4H3/t25-,26-,27-,28-/m1/s1 |
| InChIKey | UGISXRACWDPFIW-BIYDSLDMSA-N |
| XLogP | 6.17 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.59 |
| LogP ≤ 5 | 6.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|