C20H14BrNO3 — CID 124792843
(1R,8R,9S,13R)-11-(4-bromophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione (PubChem CID 124792843) has the molecular formula C20H14BrNO3 and a molecular weight of 396.24 g/mol. Its IUPAC name is (1R,8R,9S,13R)-11-(4-bromophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione.
| Compound Name | (1R,8R,9S,13R)-11-(4-bromophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
|---|---|
| PubChem CID | 124792843 |
| Molecular Formula | C20H14BrNO3 |
| Molecular Weight | 396.24 g/mol |
| Exact Mass | 395.02 |
| IUPAC Name | (1R,8R,9S,13R)-11-(4-bromophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
| SMILES | O=C1C[C@H]2c3ccccc3[C@H]1[C@H]1C(=O)N(c3ccc(Br)cc3)C(=O)[C@H]12 |
| InChI | InChI=1S/C20H14BrNO3/c21-10-5-7-11(8-6-10)22-19(24)17-14-9-15(23)16(18(17)20(22)25)13-4-2-1-3-12(13)14/h1-8,14,16-18H,9H2/t14-,16+,17-,18+/m0/s1 |
| InChIKey | KFRDYSYHQUXFSR-XOYOTBSWSA-N |
| XLogP | 3.41 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.24 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|