C20H14FNO3 — CID 98120800
(1R,8R,9R,13R)-11-(2-fluorophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione (PubChem CID 98120800) has the molecular formula C20H14FNO3 and a molecular weight of 335.33 g/mol. Its IUPAC name is (1R,8R,9R,13R)-11-(2-fluorophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione.
| Compound Name | (1R,8R,9R,13R)-11-(2-fluorophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
|---|---|
| PubChem CID | 98120800 |
| Molecular Formula | C20H14FNO3 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (1R,8R,9R,13R)-11-(2-fluorophenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
| SMILES | O=C1C[C@H]2c3ccccc3[C@H]1[C@H]1C(=O)N(c3ccccc3F)C(=O)[C@@H]12 |
| InChI | InChI=1S/C20H14FNO3/c21-13-7-3-4-8-14(13)22-19(24)17-12-9-15(23)16(18(17)20(22)25)11-6-2-1-5-10(11)12/h1-8,12,16-18H,9H2/t12-,16+,17+,18+/m0/s1 |
| InChIKey | HNHOGNAJZQZXKZ-FCRVUTKVSA-N |
| XLogP | 2.79 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|