C22H19NO3 — CID 11905273
(1S,8R,9R,13S)-11-(2,5-dimethylphenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione (PubChem CID 11905273) has the molecular formula C22H19NO3 and a molecular weight of 345.40 g/mol. Its IUPAC name is (1S,8R,9R,13S)-11-(2,5-dimethylphenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione.
| Compound Name | (1S,8R,9R,13S)-11-(2,5-dimethylphenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
|---|---|
| PubChem CID | 11905273 |
| Molecular Formula | C22H19NO3 |
| Molecular Weight | 345.40 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | (1S,8R,9R,13S)-11-(2,5-dimethylphenyl)-11-azatetracyclo[6.5.2.02,7.09,13]pentadeca-2,4,6-triene-10,12,14-trione |
| SMILES | Cc1ccc(C)c(N2C(=O)[C@@H]3[C@H](C2=O)[C@H]2CC(=O)[C@@H]3c3ccccc32)c1 |
| InChI | InChI=1S/C22H19NO3/c1-11-7-8-12(2)16(9-11)23-21(25)19-15-10-17(24)18(20(19)22(23)26)14-6-4-3-5-13(14)15/h3-9,15,18-20H,10H2,1-2H3/t15-,18-,19+,20-/m0/s1 |
| InChIKey | FEGBLEIRRMAFKY-QLIIJSOBSA-N |
| XLogP | 3.26 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.40 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|