C25H22O4 — CID 91320218
3-[hydroxy(phenyl)methyl]-4-(4-methoxyphenyl)-5-phenylcyclopentane-1,2-dione (PubChem CID 91320218) has the molecular formula C25H22O4 and a molecular weight of 386.45 g/mol. Its IUPAC name is 3-[hydroxy(phenyl)methyl]-4-(4-methoxyphenyl)-5-phenylcyclopentane-1,2-dione.
| Compound Name | 3-[hydroxy(phenyl)methyl]-4-(4-methoxyphenyl)-5-phenylcyclopentane-1,2-dione |
|---|---|
| PubChem CID | 91320218 |
| Molecular Formula | C25H22O4 |
| Molecular Weight | 386.45 g/mol |
| Exact Mass | 386.15 |
| IUPAC Name | 3-[hydroxy(phenyl)methyl]-4-(4-methoxyphenyl)-5-phenylcyclopentane-1,2-dione |
| SMILES | COc1ccc(C2C(c3ccccc3)C(=O)C(=O)C2C(O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H22O4/c1-29-19-14-12-17(13-15-19)20-21(16-8-4-2-5-9-16)24(27)25(28)22(20)23(26)18-10-6-3-7-11-18/h2-15,20-23,26H,1H3 |
| InChIKey | KECCZZRPWGIUFZ-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.45 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|