C35H36N2O5 — CID 98153067
(2R,4R,6R,8S)-2,4,6,8-tetrakis(3-methoxyphenyl)-3,7-diazabicyclo[3.3.1]nonan-9-one (PubChem CID 98153067) has the molecular formula C35H36N2O5 and a molecular weight of 564.68 g/mol. Its IUPAC name is (2R,4R,6R,8S)-2,4,6,8-tetrakis(3-methoxyphenyl)-3,7-diazabicyclo[3.3.1]nonan-9-one.
| Compound Name | (2R,4R,6R,8S)-2,4,6,8-tetrakis(3-methoxyphenyl)-3,7-diazabicyclo[3.3.1]nonan-9-one |
|---|---|
| PubChem CID | 98153067 |
| Molecular Formula | C35H36N2O5 |
| Molecular Weight | 564.68 g/mol |
| Exact Mass | 564.26 |
| IUPAC Name | (2R,4R,6R,8S)-2,4,6,8-tetrakis(3-methoxyphenyl)-3,7-diazabicyclo[3.3.1]nonan-9-one |
| SMILES | COc1cccc([C@H]2N[C@@H](c3cccc(OC)c3)C3C(=O)C2[C@H](c2cccc(OC)c2)N[C@H]3c2cccc(OC)c2)c1 |
| InChI | InChI=1S/C35H36N2O5/c1-39-25-13-5-9-21(17-25)31-29-32(22-10-6-14-26(18-22)40-2)37-34(24-12-8-16-28(20-24)42-4)30(35(29)38)33(36-31)23-11-7-15-27(19-23)41-3/h5-20,29-34,36-37H,1-4H3/t29?,30?,31-,32-,33-,34+/m0/s1 |
| InChIKey | CSZKULCODFRMIR-FWXVZOJLSA-N |
| XLogP | 5.99 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 564.68 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |