C10H12O3 — CID 11062994
2-(3-methoxyphenyl)-1,3-dioxolane (PubChem CID 11062994) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-1,3-dioxolane.
| Compound Name | 2-(3-methoxyphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 11062994 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | 2-(3-methoxyphenyl)-1,3-dioxolane |
| SMILES | COc1cccc(C2OCCO2)c1 |
| InChI | InChI=1S/C10H12O3/c1-11-9-4-2-3-8(7-9)10-12-5-6-13-10/h2-4,7,10H,5-6H2,1H3 |
| InChIKey | QQLXQZVJMJHOIT-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |