C12H14O3 — CID 89178874
4-ethenyl-2-(3-methoxyphenyl)-1,3-dioxolane (PubChem CID 89178874) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is 4-ethenyl-2-(3-methoxyphenyl)-1,3-dioxolane.
| Compound Name | 4-ethenyl-2-(3-methoxyphenyl)-1,3-dioxolane |
|---|---|
| PubChem CID | 89178874 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | 4-ethenyl-2-(3-methoxyphenyl)-1,3-dioxolane |
| SMILES | C=CC1COC(c2cccc(OC)c2)O1 |
| InChI | InChI=1S/C12H14O3/c1-3-10-8-14-12(15-10)9-5-4-6-11(7-9)13-2/h3-7,10,12H,1,8H2,2H3 |
| InChIKey | GLEQCMARZBMMIM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|