C12H15IO2 — CID 125455983
(2S,4R)-2-(iodomethyl)-4-(3-methoxyphenyl)oxolane (PubChem CID 125455983) has the molecular formula C12H15IO2 and a molecular weight of 318.15 g/mol. Its IUPAC name is (2S,4R)-2-(iodomethyl)-4-(3-methoxyphenyl)oxolane.
| Compound Name | (2S,4R)-2-(iodomethyl)-4-(3-methoxyphenyl)oxolane |
|---|---|
| PubChem CID | 125455983 |
| Molecular Formula | C12H15IO2 |
| Molecular Weight | 318.15 g/mol |
| Exact Mass | 318.01 |
| IUPAC Name | (2S,4R)-2-(iodomethyl)-4-(3-methoxyphenyl)oxolane |
| SMILES | COc1cccc([C@@H]2CO[C@H](CI)C2)c1 |
| InChI | InChI=1S/C12H15IO2/c1-14-11-4-2-3-9(5-11)10-6-12(7-13)15-8-10/h2-5,10,12H,6-8H2,1H3/t10-,12-/m0/s1 |
| InChIKey | JOXRGIQFFMBDBZ-JQWIXIFHSA-N |
| XLogP | 3.00 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.15 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|