C16H23NO3 — CID 61024965
N-(1,4-dioxan-2-ylmethyl)-3-(3-methoxyphenyl)cyclobutan-1-amine (PubChem CID 61024965) has the molecular formula C16H23NO3 and a molecular weight of 277.36 g/mol. Its IUPAC name is N-(1,4-dioxan-2-ylmethyl)-3-(3-methoxyphenyl)cyclobutan-1-amine.
| Compound Name | N-(1,4-dioxan-2-ylmethyl)-3-(3-methoxyphenyl)cyclobutan-1-amine |
|---|---|
| PubChem CID | 61024965 |
| Molecular Formula | C16H23NO3 |
| Molecular Weight | 277.36 g/mol |
| Exact Mass | 277.17 |
| IUPAC Name | N-(1,4-dioxan-2-ylmethyl)-3-(3-methoxyphenyl)cyclobutan-1-amine |
| SMILES | COc1cccc(C2CC(NCC3COCCO3)C2)c1 |
| InChI | InChI=1S/C16H23NO3/c1-18-15-4-2-3-12(9-15)13-7-14(8-13)17-10-16-11-19-5-6-20-16/h2-4,9,13-14,16-17H,5-8,10-11H2,1H3 |
| InChIKey | WCDMMWDANTVISF-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 39.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.36 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |