C17H25NO2 — CID 65105160
1-[[[3-(3-methoxyphenyl)cyclobutyl]amino]methyl]cyclopentan-1-ol (PubChem CID 65105160) has the molecular formula C17H25NO2 and a molecular weight of 275.39 g/mol. Its IUPAC name is 1-[[[3-(3-methoxyphenyl)cyclobutyl]amino]methyl]cyclopentan-1-ol.
| Compound Name | 1-[[[3-(3-methoxyphenyl)cyclobutyl]amino]methyl]cyclopentan-1-ol |
|---|---|
| PubChem CID | 65105160 |
| Molecular Formula | C17H25NO2 |
| Molecular Weight | 275.39 g/mol |
| Exact Mass | 275.19 |
| IUPAC Name | 1-[[[3-(3-methoxyphenyl)cyclobutyl]amino]methyl]cyclopentan-1-ol |
| SMILES | COc1cccc(C2CC(NCC3(O)CCCC3)C2)c1 |
| InChI | InChI=1S/C17H25NO2/c1-20-16-6-4-5-13(11-16)14-9-15(10-14)18-12-17(19)7-2-3-8-17/h4-6,11,14-15,18-19H,2-3,7-10,12H2,1H3 |
| InChIKey | QYXKGRIBUGQNRL-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.39 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |