C18H26ClNO — CID 65117012
1-[[[3-(3-chlorophenyl)cyclobutyl]amino]methyl]-3-methylcyclohexan-1-ol (PubChem CID 65117012) has the molecular formula C18H26ClNO and a molecular weight of 307.86 g/mol. Its IUPAC name is 1-[[[3-(3-chlorophenyl)cyclobutyl]amino]methyl]-3-methylcyclohexan-1-ol.
| Compound Name | 1-[[[3-(3-chlorophenyl)cyclobutyl]amino]methyl]-3-methylcyclohexan-1-ol |
|---|---|
| PubChem CID | 65117012 |
| Molecular Formula | C18H26ClNO |
| Molecular Weight | 307.86 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 1-[[[3-(3-chlorophenyl)cyclobutyl]amino]methyl]-3-methylcyclohexan-1-ol |
| SMILES | CC1CCCC(O)(CNC2CC(c3cccc(Cl)c3)C2)C1 |
| InChI | InChI=1S/C18H26ClNO/c1-13-4-3-7-18(21,11-13)12-20-17-9-15(10-17)14-5-2-6-16(19)8-14/h2,5-6,8,13,15,17,20-21H,3-4,7,9-12H2,1H3 |
| InChIKey | KUEMWSROMIZDRZ-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.86 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |