C20H22O2 — CID 101356629
(2S,3S,4S)-3-ethenyl-4-[(3-methoxyphenyl)methyl]-2-phenyloxolane (PubChem CID 101356629) has the molecular formula C20H22O2 and a molecular weight of 294.39 g/mol. Its IUPAC name is (2S,3S,4S)-3-ethenyl-4-[(3-methoxyphenyl)methyl]-2-phenyloxolane.
| Compound Name | (2S,3S,4S)-3-ethenyl-4-[(3-methoxyphenyl)methyl]-2-phenyloxolane |
|---|---|
| PubChem CID | 101356629 |
| Molecular Formula | C20H22O2 |
| Molecular Weight | 294.39 g/mol |
| Exact Mass | 294.16 |
| IUPAC Name | (2S,3S,4S)-3-ethenyl-4-[(3-methoxyphenyl)methyl]-2-phenyloxolane |
| SMILES | C=C[C@H]1[C@H](Cc2cccc(OC)c2)CO[C@@H]1c1ccccc1 |
| InChI | InChI=1S/C20H22O2/c1-3-19-17(12-15-8-7-11-18(13-15)21-2)14-22-20(19)16-9-5-4-6-10-16/h3-11,13,17,19-20H,1,12,14H2,2H3/t17-,19+,20-/m1/s1 |
| InChIKey | AOBHHCCEIONRDQ-YZGWKJHDSA-N |
| XLogP | 4.43 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.39 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|