C20H20O3 — CID 11392680
5-[(2R,3S,4S)-4-benzyl-3-ethenyloxolan-2-yl]-1,3-benzodioxole (PubChem CID 11392680) has the molecular formula C20H20O3 and a molecular weight of 308.38 g/mol. Its IUPAC name is 5-[(2R,3S,4S)-4-benzyl-3-ethenyloxolan-2-yl]-1,3-benzodioxole.
| Compound Name | 5-[(2R,3S,4S)-4-benzyl-3-ethenyloxolan-2-yl]-1,3-benzodioxole |
|---|---|
| PubChem CID | 11392680 |
| Molecular Formula | C20H20O3 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-[(2R,3S,4S)-4-benzyl-3-ethenyloxolan-2-yl]-1,3-benzodioxole |
| SMILES | C=C[C@H]1[C@H](Cc2ccccc2)CO[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C20H20O3/c1-2-17-16(10-14-6-4-3-5-7-14)12-21-20(17)15-8-9-18-19(11-15)23-13-22-18/h2-9,11,16-17,20H,1,10,12-13H2/t16-,17+,20+/m1/s1 |
| InChIKey | MRWIKAUEWPWOGL-UWVAXJGDSA-N |
| XLogP | 4.15 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|