C12H16O2 — CID 10607780
2-[(3-methoxyphenyl)methyl]oxolane (PubChem CID 10607780) has the molecular formula C12H16O2 and a molecular weight of 192.26 g/mol. Its IUPAC name is 2-[(3-methoxyphenyl)methyl]oxolane.
| Compound Name | 2-[(3-methoxyphenyl)methyl]oxolane |
|---|---|
| PubChem CID | 10607780 |
| Molecular Formula | C12H16O2 |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.12 |
| IUPAC Name | 2-[(3-methoxyphenyl)methyl]oxolane |
| SMILES | COc1cccc(CC2CCCO2)c1 |
| InChI | InChI=1S/C12H16O2/c1-13-11-5-2-4-10(8-11)9-12-6-3-7-14-12/h2,4-5,8,12H,3,6-7,9H2,1H3 |
| InChIKey | SRRJUFPPBYSRHE-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |