C17H18N2O2 — CID 132820348
(3S,5S)-5-(4-methoxyphenyl)-3-phenylpiperazin-2-one (PubChem CID 132820348) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (3S,5S)-5-(4-methoxyphenyl)-3-phenylpiperazin-2-one.
| Compound Name | (3S,5S)-5-(4-methoxyphenyl)-3-phenylpiperazin-2-one |
|---|---|
| PubChem CID | 132820348 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (3S,5S)-5-(4-methoxyphenyl)-3-phenylpiperazin-2-one |
| SMILES | COc1ccc([C@H]2CNC(=O)[C@H](c3ccccc3)N2)cc1 |
| InChI | InChI=1S/C17H18N2O2/c1-21-14-9-7-12(8-10-14)15-11-18-17(20)16(19-15)13-5-3-2-4-6-13/h2-10,15-16,19H,11H2,1H3,(H,18,20)/t15-,16+/m1/s1 |
| InChIKey | ZDMVTVAQRUNFHY-CVEARBPZSA-N |
| XLogP | 2.20 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |