C14H22N2O2 — CID 171840578
ethane;3-(4-methoxyphenyl)-1,4-diazepan-2-one (PubChem CID 171840578) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is ethane;3-(4-methoxyphenyl)-1,4-diazepan-2-one.
| Compound Name | ethane;3-(4-methoxyphenyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 171840578 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | ethane;3-(4-methoxyphenyl)-1,4-diazepan-2-one |
| SMILES | CC.COc1ccc(C2NCCCNC2=O)cc1 |
| InChI | InChI=1S/C12H16N2O2.C2H6/c1-16-10-5-3-9(4-6-10)11-12(15)14-8-2-7-13-11;1-2/h3-6,11,13H,2,7-8H2,1H3,(H,14,15);1-2H3 |
| InChIKey | FQHAMKSZCCPWEH-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |