C16H18N2O — CID 16740807
4-(4-methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine (PubChem CID 16740807) has the molecular formula C16H18N2O and a molecular weight of 254.33 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine.
| Compound Name | 4-(4-methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
|---|---|
| PubChem CID | 16740807 |
| Molecular Formula | C16H18N2O |
| Molecular Weight | 254.33 g/mol |
| Exact Mass | 254.14 |
| IUPAC Name | 4-(4-methoxyphenyl)-2,3,4,5-tetrahydro-1H-1,5-benzodiazepine |
| SMILES | COc1ccc(C2CCNc3ccccc3N2)cc1 |
| InChI | InChI=1S/C16H18N2O/c1-19-13-8-6-12(7-9-13)14-10-11-17-15-4-2-3-5-16(15)18-14/h2-9,14,17-18H,10-11H2,1H3 |
| InChIKey | POEVZLDQHFVKQX-UHFFFAOYSA-N |
| XLogP | 3.66 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.33 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|