C11H16N2O — CID 123665094
4-(4-methoxyphenyl)-1,3-diazinane (PubChem CID 123665094) has the molecular formula C11H16N2O and a molecular weight of 192.26 g/mol. Its IUPAC name is 4-(4-methoxyphenyl)-1,3-diazinane.
| Compound Name | 4-(4-methoxyphenyl)-1,3-diazinane |
|---|---|
| PubChem CID | 123665094 |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.26 g/mol |
| Exact Mass | 192.13 |
| IUPAC Name | 4-(4-methoxyphenyl)-1,3-diazinane |
| SMILES | COc1ccc(C2CCNCN2)cc1 |
| InChI | InChI=1S/C11H16N2O/c1-14-10-4-2-9(3-5-10)11-6-7-12-8-13-11/h2-5,11-13H,6-8H2,1H3 |
| InChIKey | IOLCFCKIGAHRCS-UHFFFAOYSA-N |
| XLogP | 1.28 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.26 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |