C17H19NO2 — CID 77142132
7-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydroquinoline (PubChem CID 77142132) has the molecular formula C17H19NO2 and a molecular weight of 269.34 g/mol. Its IUPAC name is 7-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 77142132 |
| Molecular Formula | C17H19NO2 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.14 |
| IUPAC Name | 7-methoxy-2-(4-methoxyphenyl)-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1ccc(C2CCc3ccc(OC)cc3N2)cc1 |
| InChI | InChI=1S/C17H19NO2/c1-19-14-7-3-12(4-8-14)16-10-6-13-5-9-15(20-2)11-17(13)18-16/h3-5,7-9,11,16,18H,6,10H2,1-2H3 |
| InChIKey | MDSNXFJIRXESQV-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |