C17H18BrNO — CID 132590268
7-bromo-2-(4-methoxyphenyl)-6-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 132590268) has the molecular formula C17H18BrNO and a molecular weight of 332.24 g/mol. Its IUPAC name is 7-bromo-2-(4-methoxyphenyl)-6-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 7-bromo-2-(4-methoxyphenyl)-6-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 132590268 |
| Molecular Formula | C17H18BrNO |
| Molecular Weight | 332.24 g/mol |
| Exact Mass | 331.06 |
| IUPAC Name | 7-bromo-2-(4-methoxyphenyl)-6-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | COc1ccc(C2CCc3cc(C)c(Br)cc3N2)cc1 |
| InChI | InChI=1S/C17H18BrNO/c1-11-9-13-5-8-16(19-17(13)10-15(11)18)12-3-6-14(20-2)7-4-12/h3-4,6-7,9-10,16,19H,5,8H2,1-2H3 |
| InChIKey | CHDWKNUBYYUKNY-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.24 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |