C16H16ClNO — CID 4030733
5-chloro-2-(4-methoxyphenyl)-7-methyl-2,3-dihydro-1H-indole (PubChem CID 4030733) has the molecular formula C16H16ClNO and a molecular weight of 273.76 g/mol. Its IUPAC name is 5-chloro-2-(4-methoxyphenyl)-7-methyl-2,3-dihydro-1H-indole.
| Compound Name | 5-chloro-2-(4-methoxyphenyl)-7-methyl-2,3-dihydro-1H-indole |
|---|---|
| PubChem CID | 4030733 |
| Molecular Formula | C16H16ClNO |
| Molecular Weight | 273.76 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 5-chloro-2-(4-methoxyphenyl)-7-methyl-2,3-dihydro-1H-indole |
| SMILES | COc1ccc(C2Cc3cc(Cl)cc(C)c3N2)cc1 |
| InChI | InChI=1S/C16H16ClNO/c1-10-7-13(17)8-12-9-15(18-16(10)12)11-3-5-14(19-2)6-4-11/h3-8,15,18H,9H2,1-2H3 |
| InChIKey | DJPAQORKBAFTSH-UHFFFAOYSA-N |
| XLogP | 4.37 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.76 |
| LogP ≤ 5 | 4.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |